C16H19N5O3 — CID 99698277
(2S)-N-(3-methyl-4-nitrophenyl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide (PubChem CID 99698277) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2S)-N-(3-methyl-4-nitrophenyl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide.
| Compound Name | (2S)-N-(3-methyl-4-nitrophenyl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 99698277 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (2S)-N-(3-methyl-4-nitrophenyl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide |
| SMILES | Cc1cc(NC(=O)N2CCCC[C@H]2c2cn[nH]c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N5O3/c1-11-8-13(5-6-14(11)21(23)24)19-16(22)20-7-3-2-4-15(20)12-9-17-18-10-12/h5-6,8-10,15H,2-4,7H2,1H3,(H,17,18)(H,19,22)/t15-/m0/s1 |
| InChIKey | QCVADELPLDYCCD-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|