About (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol
(1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol (PubChem CID 99698510) has the molecular formula C20H19F2N3O2
and a molecular weight of 371.39 g/mol. Its IUPAC name is (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol.
Molecular Properties
| Compound Name | (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol |
| PubChem CID | 99698510 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol |
| SMILES | O[C@@H](C[C@@H]1COCCN1c1ncnc2cc(F)c(F)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H19F2N3O2/c21-16-9-15-18(10-17(16)22)23-12-24-20(15)25-6-7-27-11-14(25)8-19(26)13-4-2-1-3-5-13/h1-5,9-10,12,14,19,26H,6-8,11H2/t14-,19+/m1/s1 |
| InChIKey | NNKCCYPZBWFFOA-KUHUBIRLSA-N |
| XLogP | 3.24 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol?
The IUPAC name of (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol (CID 99698510) is (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol.
What is the SMILES notation for (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol?
The canonical SMILES for (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol is O[C@@H](C[C@@H]1COCCN1c1ncnc2cc(F)c(F)cc12)c1ccccc1.
What is the InChIKey of (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol?
The InChIKey is NNKCCYPZBWFFOA-KUHUBIRLSA-N. The full InChI is InChI=1S/C20H19F2N3O2/c21-16-9-15-18(10-17(16)22)23-12-24-20(15)25-6-7-27-11-14(25)8-19(26)13-4-2-1-3-5-13/h1-5,9-10,12,14,19,26H,6-8,11H2/t14-,19+/m1/s1.
What are the key properties of (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol?
(1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol has a molecular weight of 371.39 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-[(3R)-4-(6,7-difluoroquinazolin-4-yl)morpholin-3-yl]-1-phenylethanol is sourced from PubChem (CID 99698510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).