About 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide
3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide (PubChem CID 99701090) has the molecular formula C20H18F2N2O2
and a molecular weight of 356.37 g/mol. Its IUPAC name is 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide |
| PubChem CID | 99701090 |
| Molecular Formula | C20H18F2N2O2 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(NCc2ccc(-c3c(F)cccc3F)o2)c1C |
| InChI | InChI=1S/C20H18F2N2O2/c1-12-14(20(25)23-2)5-3-8-17(12)24-11-13-9-10-18(26-13)19-15(21)6-4-7-16(19)22/h3-10,24H,11H2,1-2H3,(H,23,25) |
| InChIKey | TVIHEURORPTVMX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide?
The IUPAC name of 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide (CID 99701090) is 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide.
What is the SMILES notation for 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide?
The canonical SMILES for 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide is CNC(=O)c1cccc(NCc2ccc(-c3c(F)cccc3F)o2)c1C.
What is the InChIKey of 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide?
The InChIKey is TVIHEURORPTVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N2O2/c1-12-14(20(25)23-2)5-3-8-17(12)24-11-13-9-10-18(26-13)19-15(21)6-4-7-16(19)22/h3-10,24H,11H2,1-2H3,(H,23,25).
What are the key properties of 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide?
3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide has a molecular weight of 356.37 g/mol, XLogP of 4.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(2,6-difluorophenyl)furan-2-yl]methylamino]-N,2-dimethylbenzamide is sourced from PubChem (CID 99701090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).