C21H29N3O — CID 99701830
2-[(1S)-1-[[(3S,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propyl]phenol (PubChem CID 99701830) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[(1S)-1-[[(3S,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propyl]phenol.
| Compound Name | 2-[(1S)-1-[[(3S,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propyl]phenol |
|---|---|
| PubChem CID | 99701830 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 2-[(1S)-1-[[(3S,4S)-3-methyl-1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]propyl]phenol |
| SMILES | CC[C@H](N[C@H]1CCN(Cc2ccccn2)C[C@@H]1C)c1ccccc1O |
| InChI | InChI=1S/C21H29N3O/c1-3-19(18-9-4-5-10-21(18)25)23-20-11-13-24(14-16(20)2)15-17-8-6-7-12-22-17/h4-10,12,16,19-20,23,25H,3,11,13-15H2,1-2H3/t16-,19-,20-/m0/s1 |
| InChIKey | BFEOHTMAOUQYPU-VDGAXYAQSA-N |
| XLogP | 3.74 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|