About (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol
(1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol (PubChem CID 99701851) has the molecular formula C16H21Cl2NO3
and a molecular weight of 346.25 g/mol. Its IUPAC name is (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol.
Molecular Properties
| Compound Name | (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol |
| PubChem CID | 99701851 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol |
| SMILES | O[C@H](CNC1CCC2(CC1)OCCO2)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2NO3/c17-12-7-11(8-13(18)9-12)15(20)10-19-14-1-3-16(4-2-14)21-5-6-22-16/h7-9,14-15,19-20H,1-6,10H2/t15-/m1/s1 |
| InChIKey | FANYXIWJUWJJBL-OAHLLOKOSA-N |
| XLogP | 3.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol?
The IUPAC name of (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol (CID 99701851) is (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol.
What is the SMILES notation for (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol?
The canonical SMILES for (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol is O[C@H](CNC1CCC2(CC1)OCCO2)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol?
The InChIKey is FANYXIWJUWJJBL-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H21Cl2NO3/c17-12-7-11(8-13(18)9-12)15(20)10-19-14-1-3-16(4-2-14)21-5-6-22-16/h7-9,14-15,19-20H,1-6,10H2/t15-/m1/s1.
What are the key properties of (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol?
(1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol has a molecular weight of 346.25 g/mol, XLogP of 3.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(3,5-dichlorophenyl)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)ethanol is sourced from PubChem (CID 99701851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).