C14H16ClNO2S — CID 99702441
(4S)-6-chloro-N-cyclopent-3-en-1-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 99702441) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is (4S)-6-chloro-N-cyclopent-3-en-1-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | (4S)-6-chloro-N-cyclopent-3-en-1-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 99702441 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (4S)-6-chloro-N-cyclopent-3-en-1-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | O=S1(=O)CC[C@H](NC2CC=CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H16ClNO2S/c15-10-5-6-14-12(9-10)13(7-8-19(14,17)18)16-11-3-1-2-4-11/h1-2,5-6,9,11,13,16H,3-4,7-8H2/t13-/m0/s1 |
| InChIKey | CPQWMIZQDHWBLK-ZDUSSCGKSA-N |
| XLogP | 2.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|