About (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol
(1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol (PubChem CID 99702550) has the molecular formula C16H25NO3S
and a molecular weight of 311.45 g/mol. Its IUPAC name is (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol.
Molecular Properties
| Compound Name | (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol |
| PubChem CID | 99702550 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol |
| SMILES | C[C@@H](C[C@H](O)c1cccs1)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H25NO3S/c1-12(11-14(18)15-3-2-10-21-15)17-13-4-6-16(7-5-13)19-8-9-20-16/h2-3,10,12-14,17-18H,4-9,11H2,1H3/t12-,14-/m0/s1 |
| InChIKey | HRHYKHSWBJHWIQ-JSGCOSHPSA-N |
| XLogP | 2.84 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol?
The IUPAC name of (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol (CID 99702550) is (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol.
What is the SMILES notation for (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol?
The canonical SMILES for (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol is C[C@@H](C[C@H](O)c1cccs1)NC1CCC2(CC1)OCCO2.
What is the InChIKey of (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol?
The InChIKey is HRHYKHSWBJHWIQ-JSGCOSHPSA-N. The full InChI is InChI=1S/C16H25NO3S/c1-12(11-14(18)15-3-2-10-21-15)17-13-4-6-16(7-5-13)19-8-9-20-16/h2-3,10,12-14,17-18H,4-9,11H2,1H3/t12-,14-/m0/s1.
What are the key properties of (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol?
(1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol has a molecular weight of 311.45 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3S)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)-1-thiophen-2-ylbutan-1-ol is sourced from PubChem (CID 99702550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).