C20H32N2O2 — CID 99702928
2-[(1R)-1-[[1-[(1S,2S)-2-hydroxycyclohexyl]piperidin-4-yl]amino]propyl]phenol (PubChem CID 99702928) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-[(1R)-1-[[1-[(1S,2S)-2-hydroxycyclohexyl]piperidin-4-yl]amino]propyl]phenol.
| Compound Name | 2-[(1R)-1-[[1-[(1S,2S)-2-hydroxycyclohexyl]piperidin-4-yl]amino]propyl]phenol |
|---|---|
| PubChem CID | 99702928 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 2-[(1R)-1-[[1-[(1S,2S)-2-hydroxycyclohexyl]piperidin-4-yl]amino]propyl]phenol |
| SMILES | CC[C@@H](NC1CCN([C@H]2CCCC[C@@H]2O)CC1)c1ccccc1O |
| InChI | InChI=1S/C20H32N2O2/c1-2-17(16-7-3-5-9-19(16)23)21-15-11-13-22(14-12-15)18-8-4-6-10-20(18)24/h3,5,7,9,15,17-18,20-21,23-24H,2,4,6,8,10-14H2,1H3/t17-,18+,20+/m1/s1 |
| InChIKey | ROCXAIJDYGTRRQ-HBFSDRIKSA-N |
| XLogP | 3.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|