About (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol
(1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol (PubChem CID 99703085) has the molecular formula C18H25NO3
and a molecular weight of 303.40 g/mol. Its IUPAC name is (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol |
| PubChem CID | 99703085 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol |
| SMILES | O[C@]1(CNC2CCC3(CC2)OCCO3)CCc2ccccc21 |
| InChI | InChI=1S/C18H25NO3/c20-17(8-5-14-3-1-2-4-16(14)17)13-19-15-6-9-18(10-7-15)21-11-12-22-18/h1-4,15,19-20H,5-13H2/t17-/m0/s1 |
| InChIKey | UAESOKFVEIKZPM-KRWDZBQOSA-N |
| XLogP | 2.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol?
The IUPAC name of (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol (CID 99703085) is (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol.
What is the SMILES notation for (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol?
The canonical SMILES for (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol is O[C@]1(CNC2CCC3(CC2)OCCO3)CCc2ccccc21.
What is the InChIKey of (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol?
The InChIKey is UAESOKFVEIKZPM-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H25NO3/c20-17(8-5-14-3-1-2-4-16(14)17)13-19-15-6-9-18(10-7-15)21-11-12-22-18/h1-4,15,19-20H,5-13H2/t17-/m0/s1.
What are the key properties of (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol?
(1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol has a molecular weight of 303.40 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]-2,3-dihydroinden-1-ol is sourced from PubChem (CID 99703085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).