C16H20F3NO3 — CID 99703106
(2S)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2-(3,4,5-trifluorophenyl)ethanol (PubChem CID 99703106) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is (2S)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2-(3,4,5-trifluorophenyl)ethanol.
| Compound Name | (2S)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2-(3,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 99703106 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (2S)-2-(1,4-dioxaspiro[4.5]decan-8-ylamino)-2-(3,4,5-trifluorophenyl)ethanol |
| SMILES | OC[C@@H](NC1CCC2(CC1)OCCO2)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H20F3NO3/c17-12-7-10(8-13(18)15(12)19)14(9-21)20-11-1-3-16(4-2-11)22-5-6-23-16/h7-8,11,14,20-21H,1-6,9H2/t14-/m1/s1 |
| InChIKey | PBEPLLNKJYRVLA-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|