C15H25N3O — CID 99703454
(2S)-2-amino-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpropanamide (PubChem CID 99703454) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpropanamide.
| Compound Name | (2S)-2-amino-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 99703454 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (2S)-2-amino-N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethylpropanamide |
| SMILES | CCN(Cc1ccc(CN(C)C)cc1)C(=O)[C@H](C)N |
| InChI | InChI=1S/C15H25N3O/c1-5-18(15(19)12(2)16)11-14-8-6-13(7-9-14)10-17(3)4/h6-9,12H,5,10-11,16H2,1-4H3/t12-/m0/s1 |
| InChIKey | CWNFSNWVWZFQLI-LBPRGKRZSA-N |
| XLogP | 1.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |