C12H16N4O — CID 99704171
(8aS)-7-(6-methyl-2-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 99704171) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is (8aS)-7-(6-methyl-2-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aS)-7-(6-methyl-2-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 99704171 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (8aS)-7-(6-methyl-2-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Cc1cccc(N2CCN3C(=O)NC[C@H]3C2)n1 |
| InChI | InChI=1S/C12H16N4O/c1-9-3-2-4-11(14-9)15-5-6-16-10(8-15)7-13-12(16)17/h2-4,10H,5-8H2,1H3,(H,13,17)/t10-/m0/s1 |
| InChIKey | STANRTIGSLIBPN-JTQLQIEISA-N |
| XLogP | 0.60 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |