C10H15F3N2O3 — CID 99704415
5,5-diethyl-3-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]imidazolidine-2,4-dione (PubChem CID 99704415) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 5,5-diethyl-3-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99704415 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5,5-diethyl-3-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(C[C@H](O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C10H15F3N2O3/c1-3-9(4-2)7(17)15(8(18)14-9)5-6(16)10(11,12)13/h6,16H,3-5H2,1-2H3,(H,14,18)/t6-/m0/s1 |
| InChIKey | XDMQHNIUDYGTQH-LURJTMIESA-N |
| XLogP | 1.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|