C11H13F3N2O — CID 99705263
(2S)-2-amino-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide (PubChem CID 99705263) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is (2S)-2-amino-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide.
| Compound Name | (2S)-2-amino-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 99705263 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (2S)-2-amino-N-methyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide |
| SMILES | C[C@H](N)C(=O)N(C)Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H13F3N2O/c1-6(15)11(17)16(2)5-7-3-8(12)10(14)9(13)4-7/h3-4,6H,5,15H2,1-2H3/t6-/m0/s1 |
| InChIKey | AKOACTBEJLPMAJ-LURJTMIESA-N |
| XLogP | 1.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|