C7H13F2NO — CID 99707197
trans-(1S,3S)-3-(difluoromethoxy)cyclohexan-1-amine (PubChem CID 99707197) has the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. Its IUPAC name is trans-(1S,3S)-3-(difluoromethoxy)cyclohexan-1-amine.
| Compound Name | trans-(1S,3S)-3-(difluoromethoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 99707197 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | trans-(1S,3S)-3-(difluoromethoxy)cyclohexan-1-amine |
| SMILES | N[C@H]1CCC[C@H](OC(F)F)C1 |
| InChI | InChI=1S/C7H13F2NO/c8-7(9)11-6-3-1-2-5(10)4-6/h5-7H,1-4,10H2/t5-,6-/m0/s1 |
| InChIKey | USDBMIDEVGRNIN-WDSKDSINSA-N |
| XLogP | 1.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |