C19H16ClN5O9S4 — CID 99711377
6-[[(4R)-1-(2-chloro-5-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-ethylsulfonyl-1,3-benzothiazole-7-sulfonic acid (PubChem CID 99711377) has the molecular formula C19H16ClN5O9S4 and a molecular weight of 622.08 g/mol. Its IUPAC name is 6-[[(4R)-1-(2-chloro-5-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-ethylsulfonyl-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | 6-[[(4R)-1-(2-chloro-5-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-ethylsulfonyl-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 99711377 |
| Molecular Formula | C19H16ClN5O9S4 |
| Molecular Weight | 622.08 g/mol |
| Exact Mass | 620.95 |
| IUPAC Name | 6-[[(4R)-1-(2-chloro-5-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-ethylsulfonyl-1,3-benzothiazole-7-sulfonic acid |
| SMILES | CCS(=O)(=O)c1nc2ccc(/N=N/[C@H]3C(=O)N(c4cc(S(=O)(=O)O)ccc4Cl)N=C3C)c(S(=O)(=O)O)c2s1 |
| InChI | InChI=1S/C19H16ClN5O9S4/c1-3-36(27,28)19-21-12-6-7-13(17(16(12)35-19)38(32,33)34)22-23-15-9(2)24-25(18(15)26)14-8-10(37(29,30)31)4-5-11(14)20/h4-8,15H,3H2,1-2H3,(H,29,30,31)(H,32,33,34)/b23-22+/t15-/m1/s1 |
| InChIKey | DINGRJPZHNSXIM-MTLKIYMJSA-N |
| XLogP | 3.11 |
| TPSA | 213.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.08 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|