About (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol
(2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol (PubChem CID 99712353) has the molecular formula C17H21F2N3O2
and a molecular weight of 337.37 g/mol. Its IUPAC name is (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol |
| PubChem CID | 99712353 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol |
| SMILES | C[C@](O)(CNc1ccnc2c(F)cc(F)cc12)CN1CCOCC1 |
| InChI | InChI=1S/C17H21F2N3O2/c1-17(23,11-22-4-6-24-7-5-22)10-21-15-2-3-20-16-13(15)8-12(18)9-14(16)19/h2-3,8-9,23H,4-7,10-11H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | LNGAMSJDFDCSRO-KRWDZBQOSA-N |
| XLogP | 2.01 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol?
The IUPAC name of (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol (CID 99712353) is (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol.
What is the SMILES notation for (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol?
The canonical SMILES for (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol is C[C@](O)(CNc1ccnc2c(F)cc(F)cc12)CN1CCOCC1.
What is the InChIKey of (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol?
The InChIKey is LNGAMSJDFDCSRO-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H21F2N3O2/c1-17(23,11-22-4-6-24-7-5-22)10-21-15-2-3-20-16-13(15)8-12(18)9-14(16)19/h2-3,8-9,23H,4-7,10-11H2,1H3,(H,20,21)/t17-/m0/s1.
What are the key properties of (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol?
(2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol has a molecular weight of 337.37 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(6,8-difluoroquinolin-4-yl)amino]-2-methyl-3-morpholin-4-ylpropan-2-ol is sourced from PubChem (CID 99712353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).