About (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide
(3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide (PubChem CID 99713793) has the molecular formula C19H28N4O2
and a molecular weight of 344.46 g/mol. Its IUPAC name is (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide.
Molecular Properties
| Compound Name | (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide |
| PubChem CID | 99713793 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide |
| SMILES | Cc1noc(C)c1[C@@H](C)CC(=O)Nc1cc(C2CCCCC2)nn1C |
| InChI | InChI=1S/C19H28N4O2/c1-12(19-13(2)22-25-14(19)3)10-18(24)20-17-11-16(21-23(17)4)15-8-6-5-7-9-15/h11-12,15H,5-10H2,1-4H3,(H,20,24)/t12-/m0/s1 |
| InChIKey | BZBQQPULFSSIKD-LBPRGKRZSA-N |
| XLogP | 4.20 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide?
The IUPAC name of (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide (CID 99713793) is (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide.
What is the SMILES notation for (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide?
The canonical SMILES for (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide is Cc1noc(C)c1[C@@H](C)CC(=O)Nc1cc(C2CCCCC2)nn1C.
What is the InChIKey of (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide?
The InChIKey is BZBQQPULFSSIKD-LBPRGKRZSA-N. The full InChI is InChI=1S/C19H28N4O2/c1-12(19-13(2)22-25-14(19)3)10-18(24)20-17-11-16(21-23(17)4)15-8-6-5-7-9-15/h11-12,15H,5-10H2,1-4H3,(H,20,24)/t12-/m0/s1.
What are the key properties of (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide?
(3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide has a molecular weight of 344.46 g/mol, XLogP of 4.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-(3-cyclohexyl-1-methylpyrazol-5-yl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)butanamide is sourced from PubChem (CID 99713793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).