C18H26N4O3 — CID 99714491
(2R,4S)-2-(furan-2-yl)-N-[1-(3-methoxypropyl)pyrazol-3-yl]-4-methylpiperidine-1-carboxamide (PubChem CID 99714491) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R,4S)-2-(furan-2-yl)-N-[1-(3-methoxypropyl)pyrazol-3-yl]-4-methylpiperidine-1-carboxamide.
| Compound Name | (2R,4S)-2-(furan-2-yl)-N-[1-(3-methoxypropyl)pyrazol-3-yl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 99714491 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (2R,4S)-2-(furan-2-yl)-N-[1-(3-methoxypropyl)pyrazol-3-yl]-4-methylpiperidine-1-carboxamide |
| SMILES | COCCCn1ccc(NC(=O)N2CC[C@H](C)C[C@@H]2c2ccco2)n1 |
| InChI | InChI=1S/C18H26N4O3/c1-14-6-10-22(15(13-14)16-5-3-12-25-16)18(23)19-17-7-9-21(20-17)8-4-11-24-2/h3,5,7,9,12,14-15H,4,6,8,10-11,13H2,1-2H3,(H,19,20,23)/t14-,15+/m0/s1 |
| InChIKey | UETONSTUPRGEJK-LSDHHAIUSA-N |
| XLogP | 3.52 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|