C13H19F3N2O2S — CID 99715742
2-[(3R)-1-(2,2-dimethoxyethyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 99715742) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-[(3R)-1-(2,2-dimethoxyethyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 2-[(3R)-1-(2,2-dimethoxyethyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 99715742 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[(3R)-1-(2,2-dimethoxyethyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | COC(CN1CCC[C@@H](c2nc(C(F)(F)F)cs2)C1)OC |
| InChI | InChI=1S/C13H19F3N2O2S/c1-19-11(20-2)7-18-5-3-4-9(6-18)12-17-10(8-21-12)13(14,15)16/h8-9,11H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | ILPHZOXPLMDHMN-SECBINFHSA-N |
| XLogP | 2.96 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|