C18H20N6O2 — CID 99716475
(3R)-3-acetyl-2-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3,4-dihydropyrazole-5-carboxamide (PubChem CID 99716475) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is (3R)-3-acetyl-2-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R)-3-acetyl-2-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 99716475 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (3R)-3-acetyl-2-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CC(=O)[C@H]1CC(C(=O)Nc2nnc3n2CCCC3)=NN1c1ccccc1 |
| InChI | InChI=1S/C18H20N6O2/c1-12(25)15-11-14(22-24(15)13-7-3-2-4-8-13)17(26)19-18-21-20-16-9-5-6-10-23(16)18/h2-4,7-8,15H,5-6,9-11H2,1H3,(H,19,21,26)/t15-/m1/s1 |
| InChIKey | MKQCYDZNKCBYTI-OAHLLOKOSA-N |
| XLogP | 1.78 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |