C12H12Cl2N4O2S — CID 99716962
(2S)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide (PubChem CID 99716962) has the molecular formula C12H12Cl2N4O2S and a molecular weight of 347.23 g/mol. Its IUPAC name is (2S)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide.
| Compound Name | (2S)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 99716962 |
| Molecular Formula | C12H12Cl2N4O2S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (2S)-2-(3,5-dichlorophenyl)-2-hydroxy-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide |
| SMILES | Cn1c(CNC(=O)[C@@H](O)c2cc(Cl)cc(Cl)c2)n[nH]c1=S |
| InChI | InChI=1S/C12H12Cl2N4O2S/c1-18-9(16-17-12(18)21)5-15-11(20)10(19)6-2-7(13)4-8(14)3-6/h2-4,10,19H,5H2,1H3,(H,15,20)(H,17,21)/t10-/m0/s1 |
| InChIKey | KJLSMSDJPUZGOV-JTQLQIEISA-N |
| XLogP | 2.13 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|