About N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide
N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide (PubChem CID 99718357) has the molecular formula C22H18N2O
and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide.
Molecular Properties
| Compound Name | N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide |
| PubChem CID | 99718357 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide |
| SMILES | C#Cc1cccc(N(C)C(=O)c2cccc(-c3ccccn3)c2C)c1 |
| InChI | InChI=1S/C22H18N2O/c1-4-17-9-7-10-18(15-17)24(3)22(25)20-12-8-11-19(16(20)2)21-13-5-6-14-23-21/h1,5-15H,2-3H3 |
| InChIKey | MYLYPZXTTDRKGA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide?
The IUPAC name of N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide (CID 99718357) is N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide.
What is the SMILES notation for N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide?
The canonical SMILES for N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide is C#Cc1cccc(N(C)C(=O)c2cccc(-c3ccccn3)c2C)c1.
What is the InChIKey of N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide?
The InChIKey is MYLYPZXTTDRKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O/c1-4-17-9-7-10-18(15-17)24(3)22(25)20-12-8-11-19(16(20)2)21-13-5-6-14-23-21/h1,5-15H,2-3H3.
What are the key properties of N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide?
N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide has a molecular weight of 326.40 g/mol, XLogP of 4.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethynylphenyl)-N,2-dimethyl-3-pyridin-2-ylbenzamide is sourced from PubChem (CID 99718357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).