C12H18N4O2 — CID 99718980
6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitropyridin-2-amine (PubChem CID 99718980) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitropyridin-2-amine.
| Compound Name | 6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 99718980 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitropyridin-2-amine |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2ccc([N+](=O)[O-])c(N)n2)C1 |
| InChI | InChI=1S/C12H18N4O2/c1-8-5-9(2)7-15(6-8)11-4-3-10(16(17)18)12(13)14-11/h3-4,8-9H,5-7H2,1-2H3,(H2,13,14)/t8-,9-/m1/s1 |
| InChIKey | AIRBASRMKCIKSZ-RKDXNWHRSA-N |
| XLogP | 2.05 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|