C21H24F4O7 — CID 99720961
diethyl (1S,2S,3S,4R)-4-hydroxy-4-methyl-6-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexane-1,3-dicarboxylate (PubChem CID 99720961) has the molecular formula C21H24F4O7 and a molecular weight of 464.41 g/mol. Its IUPAC name is diethyl (1S,2S,3S,4R)-4-hydroxy-4-methyl-6-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexane-1,3-dicarboxylate.
| Compound Name | diethyl (1S,2S,3S,4R)-4-hydroxy-4-methyl-6-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 99720961 |
| Molecular Formula | C21H24F4O7 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | diethyl (1S,2S,3S,4R)-4-hydroxy-4-methyl-6-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexane-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@@](C)(O)[C@@H](C(=O)OCC)[C@@H]1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C21H24F4O7/c1-4-30-17(27)15-13(26)10-20(3,29)16(18(28)31-5-2)14(15)11-7-6-8-12(9-11)32-21(24,25)19(22)23/h6-9,14-16,19,29H,4-5,10H2,1-3H3/t14-,15-,16-,20-/m1/s1 |
| InChIKey | DSQYEZBBAZDPKZ-AXHMDWHKSA-N |
| XLogP | 3.09 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|