C12H22O2 — CID 99722808
(1S,2R,3S,4R)-1,2,3,7,7-pentamethylbicyclo[2.2.1]heptane-2,3-diol (PubChem CID 99722808) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1S,2R,3S,4R)-1,2,3,7,7-pentamethylbicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | (1S,2R,3S,4R)-1,2,3,7,7-pentamethylbicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 99722808 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1S,2R,3S,4R)-1,2,3,7,7-pentamethylbicyclo[2.2.1]heptane-2,3-diol |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@](C)(O)[C@@]2(C)O |
| InChI | InChI=1S/C12H22O2/c1-9(2)8-6-7-10(9,3)12(5,14)11(8,4)13/h8,13-14H,6-7H2,1-5H3/t8-,10+,11+,12-/m1/s1 |
| InChIKey | NWNHTCHLLIXGBV-NUGNTBJXSA-N |
| XLogP | 1.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |