C28H20Br2O — CID 99723181
(1R,2S,9S,10S)-1,10-dibromo-2,9-diphenyl-17-oxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene (PubChem CID 99723181) has the molecular formula C28H20Br2O and a molecular weight of 532.28 g/mol. Its IUPAC name is (1R,2S,9S,10S)-1,10-dibromo-2,9-diphenyl-17-oxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene.
| Compound Name | (1R,2S,9S,10S)-1,10-dibromo-2,9-diphenyl-17-oxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene |
|---|---|
| PubChem CID | 99723181 |
| Molecular Formula | C28H20Br2O |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | (1R,2S,9S,10S)-1,10-dibromo-2,9-diphenyl-17-oxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene |
| SMILES | Br[C@]12O[C@](Br)(c3ccccc31)[C@@H](c1ccccc1)c1ccccc1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C28H20Br2O/c29-27-23-17-9-10-18-24(23)28(30,31-27)26(20-13-5-2-6-14-20)22-16-8-7-15-21(22)25(27)19-11-3-1-4-12-19/h1-18,25-26H/t25-,26-,27-,28+/m0/s1 |
| InChIKey | GMNVPANOTJWJLV-LAJGZZDBSA-N |
| XLogP | 7.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|