C28H23Cl2N — CID 99724073
(2R,6R,9S,10R,14S)-9-(2,3-dichlorophenyl)-8-azahexacyclo[13.7.1.02,6.08,23.010,14.016,21]tricosa-1(22),3,12,15(23),16,18,20-heptaene (PubChem CID 99724073) has the molecular formula C28H23Cl2N and a molecular weight of 444.41 g/mol. Its IUPAC name is (2R,6R,9S,10R,14S)-9-(2,3-dichlorophenyl)-8-azahexacyclo[13.7.1.02,6.08,23.010,14.016,21]tricosa-1(22),3,12,15(23),16,18,20-heptaene.
| Compound Name | (2R,6R,9S,10R,14S)-9-(2,3-dichlorophenyl)-8-azahexacyclo[13.7.1.02,6.08,23.010,14.016,21]tricosa-1(22),3,12,15(23),16,18,20-heptaene |
|---|---|
| PubChem CID | 99724073 |
| Molecular Formula | C28H23Cl2N |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (2R,6R,9S,10R,14S)-9-(2,3-dichlorophenyl)-8-azahexacyclo[13.7.1.02,6.08,23.010,14.016,21]tricosa-1(22),3,12,15(23),16,18,20-heptaene |
| SMILES | Clc1cccc([C@@H]2[C@@H]3CC=C[C@@H]3c3c4c(cc5ccccc35)[C@@H]3C=CC[C@H]3CN42)c1Cl |
| InChI | InChI=1S/C28H23Cl2N/c29-24-13-5-12-22(26(24)30)27-21-11-4-10-20(21)25-19-8-2-1-6-16(19)14-23-18-9-3-7-17(18)15-31(27)28(23)25/h1-6,8-10,12-14,17-18,20-21,27H,7,11,15H2/t17-,18+,20-,21+,27-/m0/s1 |
| InChIKey | OOLWDDHOESJTDM-HZGFKZENSA-N |
| XLogP | 8.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|