C24H26N2O2 — CID 99724415
(1R,6R)-N'-[(1R)-2,2-diphenylcyclopropanecarbonyl]bicyclo[4.1.0]heptane-7-carbohydrazide (PubChem CID 99724415) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (1R,6R)-N'-[(1R)-2,2-diphenylcyclopropanecarbonyl]bicyclo[4.1.0]heptane-7-carbohydrazide.
| Compound Name | (1R,6R)-N'-[(1R)-2,2-diphenylcyclopropanecarbonyl]bicyclo[4.1.0]heptane-7-carbohydrazide |
|---|---|
| PubChem CID | 99724415 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (1R,6R)-N'-[(1R)-2,2-diphenylcyclopropanecarbonyl]bicyclo[4.1.0]heptane-7-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CC1(c1ccccc1)c1ccccc1)C1[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C24H26N2O2/c27-22(25-26-23(28)21-18-13-7-8-14-19(18)21)20-15-24(20,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-6,9-12,18-21H,7-8,13-15H2,(H,25,27)(H,26,28)/t18-,19-,20+/m1/s1 |
| InChIKey | AZKGMFBPXAUNBU-AQNXPRMDSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|