C22H28NO4P — CID 99724423
(1S,2S,4S,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ol (PubChem CID 99724423) has the molecular formula C22H28NO4P and a molecular weight of 401.44 g/mol. Its IUPAC name is (1S,2S,4S,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ol.
| Compound Name | (1S,2S,4S,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 99724423 |
| Molecular Formula | C22H28NO4P |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (1S,2S,4S,5S)-9-dimethoxyphosphoryl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ol |
| SMILES | COP(=O)(OC)C1(O)[C@H]2CCC[C@H]1[C@@H](c1ccccc1)N[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H28NO4P/c1-26-28(25,27-2)22(24)18-14-9-15-19(22)21(17-12-7-4-8-13-17)23-20(18)16-10-5-3-6-11-16/h3-8,10-13,18-21,23-24H,9,14-15H2,1-2H3/t18-,19-,20+,21+/m0/s1 |
| InChIKey | FVURVDZRDOAWTJ-UWHLTILDSA-N |
| XLogP | 4.66 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|