C18H21ClN2O3 — CID 99725593
N-[[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chlorophenyl)acetamide (PubChem CID 99725593) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-[[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | N-[[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 99725593 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chlorophenyl)acetamide |
| SMILES | CC(=O)N(CN1C(=O)[C@H]2CC[C@H](C)C[C@@H]2C1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-11-6-7-15-16(8-11)18(24)21(17(15)23)10-20(12(2)22)14-5-3-4-13(19)9-14/h3-5,9,11,15-16H,6-8,10H2,1-2H3/t11-,15-,16-/m0/s1 |
| InChIKey | RAVZPKQROICIAF-UVBJJODRSA-N |
| XLogP | 3.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|