C9H8Br2O — CID 99725829
(2R,3S,6R,7R,9R)-1,4-dibromopentacyclo[4.3.0.02,5.03,8.04,7]nonan-9-ol (PubChem CID 99725829) has the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. Its IUPAC name is (2R,3S,6R,7R,9R)-1,4-dibromopentacyclo[4.3.0.02,5.03,8.04,7]nonan-9-ol.
| Compound Name | (2R,3S,6R,7R,9R)-1,4-dibromopentacyclo[4.3.0.02,5.03,8.04,7]nonan-9-ol |
|---|---|
| PubChem CID | 99725829 |
| Molecular Formula | C9H8Br2O |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | (2R,3S,6R,7R,9R)-1,4-dibromopentacyclo[4.3.0.02,5.03,8.04,7]nonan-9-ol |
| SMILES | O[C@@H]1C2[C@@H]3[C@@H]4C5[C@@H]([C@H]2C53Br)C14Br |
| InChI | InChI=1S/C9H8Br2O/c10-8-2-1-3(8)5-6(8)4(2)9(5,11)7(1)12/h1-7,12H/t1?,2-,3+,4-,5-,6?,7-,8?,9?/m1/s1 |
| InChIKey | GBAQWXVCNHZZOQ-CHYXJKDLSA-N |
| XLogP | 1.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|