C17H11Cl6NO2 — CID 99727206
(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-(3,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 99727206) has the molecular formula C17H11Cl6NO2 and a molecular weight of 474.00 g/mol. Its IUPAC name is (1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-(3,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-(3,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 99727206 |
| Molecular Formula | C17H11Cl6NO2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 470.89 |
| IUPAC Name | (1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-(3,5-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)[C@H]3[C@H](C2=O)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]3(Cl)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C17H11Cl6NO2/c1-6-3-7(2)5-8(4-6)24-13(25)9-10(14(24)26)16(21)12(19)11(18)15(9,20)17(16,22)23/h3-5,9-10H,1-2H3/t9-,10-,15-,16-/m1/s1 |
| InChIKey | QSTZEKRXQRQJSR-DJUAPZDMSA-N |
| XLogP | 5.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|