About (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one
(3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one (PubChem CID 99727924) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 99727924 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CN1C(=O)c2cccn2C[C@H]1CN |
| InChI | InChI=1S/C9H13N3O/c1-11-7(5-10)6-12-4-2-3-8(12)9(11)13/h2-4,7H,5-6,10H2,1H3/t7-/m1/s1 |
| InChIKey | LTPNIBJYDJTQNJ-SSDOTTSWSA-N |
| XLogP | -0.10 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one (CID 99727924) is (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one is CN1C(=O)c2cccn2C[C@H]1CN.
What is the InChIKey of (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is LTPNIBJYDJTQNJ-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H13N3O/c1-11-7(5-10)6-12-4-2-3-8(12)9(11)13/h2-4,7H,5-6,10H2,1H3/t7-/m1/s1.
What are the key properties of (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one?
(3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 179.22 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(aminomethyl)-2-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 99727924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).