C28H25N3O4 — CID 99736654
(3aR,7aR)-2-[4-[[(1S)-1,2-diphenylethyl]amino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 99736654) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is (3aR,7aR)-2-[4-[[(1S)-1,2-diphenylethyl]amino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[4-[[(1S)-1,2-diphenylethyl]amino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 99736654 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (3aR,7aR)-2-[4-[[(1S)-1,2-diphenylethyl]amino]-3-nitrophenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1c1ccc(N[C@@H](Cc2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H25N3O4/c32-27-22-13-7-8-14-23(22)28(33)30(27)21-15-16-24(26(18-21)31(34)35)29-25(20-11-5-2-6-12-20)17-19-9-3-1-4-10-19/h1-12,15-16,18,22-23,25,29H,13-14,17H2/t22-,23-,25+/m1/s1 |
| InChIKey | NAVYTIZMNSCMAS-OYRHQHFDSA-N |
| XLogP | 5.45 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|