C48H52N2P2+2 — CID 99736896
[2,3-dimethyl-3-[(3R)-3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl]butan-2-yl]-triphenylphosphanium (PubChem CID 99736896) has the molecular formula C48H52N2P2+2 and a molecular weight of 718.91 g/mol. Its IUPAC name is [2,3-dimethyl-3-[(3R)-3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl]butan-2-yl]-triphenylphosphanium.
| Compound Name | [2,3-dimethyl-3-[(3R)-3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl]butan-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 99736896 |
| Molecular Formula | C48H52N2P2+2 |
| Molecular Weight | 718.91 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | [2,3-dimethyl-3-[(3R)-3,4,4-trimethyl-5-triphenylphosphaniumyl-3H-pyrazol-2-yl]butan-2-yl]-triphenylphosphanium |
| SMILES | C[C@H]1N(C(C)(C)C(C)(C)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)N=C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C48H52N2P2/c1-38-46(2,3)45(51(39-26-14-8-15-27-39,40-28-16-9-17-29-40)41-30-18-10-19-31-41)49-50(38)47(4,5)48(6,7)52(42-32-20-11-21-33-42,43-34-22-12-23-35-43)44-36-24-13-25-37-44/h8-38H,1-7H3/q+2/t38-/m1/s1 |
| InChIKey | VBDIDCWENZNWIZ-KXQOOQHDSA-N |
| XLogP | 9.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.91 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|