C9H18N4O — CID 99737543
[1-[(2R,3S)-2-amino-3-methylpentyl]triazol-4-yl]methanol (PubChem CID 99737543) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is [1-[(2R,3S)-2-amino-3-methylpentyl]triazol-4-yl]methanol.
| Compound Name | [1-[(2R,3S)-2-amino-3-methylpentyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 99737543 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | [1-[(2R,3S)-2-amino-3-methylpentyl]triazol-4-yl]methanol |
| SMILES | CC[C@H](C)[C@@H](N)Cn1cc(CO)nn1 |
| InChI | InChI=1S/C9H18N4O/c1-3-7(2)9(10)5-13-4-8(6-14)11-12-13/h4,7,9,14H,3,5-6,10H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | RVJDLZQSGTWMLW-CBAPKCEASA-N |
| XLogP | 0.14 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |