C8H12N2O4S — CID 99737774
methyl (2S,3S)-2-amino-3-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate (PubChem CID 99737774) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is methyl (2S,3S)-2-amino-3-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate.
| Compound Name | methyl (2S,3S)-2-amino-3-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate |
|---|---|
| PubChem CID | 99737774 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | methyl (2S,3S)-2-amino-3-(2,4-dioxo-1,3-thiazolidin-3-yl)butanoate |
| SMILES | COC(=O)[C@@H](N)[C@H](C)N1C(=O)CSC1=O |
| InChI | InChI=1S/C8H12N2O4S/c1-4(6(9)7(12)14-2)10-5(11)3-15-8(10)13/h4,6H,3,9H2,1-2H3/t4-,6-/m0/s1 |
| InChIKey | YIWYTWZBMLKXBS-NJGYIYPDSA-N |
| XLogP | -0.43 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|