About diphenylboranyl (2S)-2-amino-4-methylpentanoate
diphenylboranyl (2S)-2-amino-4-methylpentanoate (PubChem CID 99738149) has the molecular formula C18H22BNO2
and a molecular weight of 295.19 g/mol. Its IUPAC name is diphenylboranyl (2S)-2-amino-4-methylpentanoate.
Molecular Properties
| Compound Name | diphenylboranyl (2S)-2-amino-4-methylpentanoate |
| PubChem CID | 99738149 |
| Molecular Formula | C18H22BNO2 |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | diphenylboranyl (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(C)C[C@H](N)C(=O)OB(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22BNO2/c1-14(2)13-17(20)18(21)22-19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17H,13,20H2,1-2H3/t17-/m0/s1 |
| InChIKey | HEFYWEFHUCZFOZ-KRWDZBQOSA-N |
| XLogP | 1.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diphenylboranyl (2S)-2-amino-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylboranyl (2S)-2-amino-4-methylpentanoate?
The IUPAC name of diphenylboranyl (2S)-2-amino-4-methylpentanoate (CID 99738149) is diphenylboranyl (2S)-2-amino-4-methylpentanoate.
What is the SMILES notation for diphenylboranyl (2S)-2-amino-4-methylpentanoate?
The canonical SMILES for diphenylboranyl (2S)-2-amino-4-methylpentanoate is CC(C)C[C@H](N)C(=O)OB(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylboranyl (2S)-2-amino-4-methylpentanoate?
The InChIKey is HEFYWEFHUCZFOZ-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H22BNO2/c1-14(2)13-17(20)18(21)22-19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17H,13,20H2,1-2H3/t17-/m0/s1.
What are the key properties of diphenylboranyl (2S)-2-amino-4-methylpentanoate?
diphenylboranyl (2S)-2-amino-4-methylpentanoate has a molecular weight of 295.19 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylboranyl (2S)-2-amino-4-methylpentanoate is sourced from PubChem (CID 99738149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).