[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid

C9H12BNO2S — CID 99738203

IUPAC[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid
SMILESOB(O)c1ccc([C@H]2NCCS2)cc1
InChIInChI=1S/C9H12BNO2S/c12-10(13)8-3-1-7(2-4-8)9-11-5-6-14-9/h1-4,9,11-13H,5-6H2/t9-/m0/s1
InChIKeyJXWCKTPGUFGAKU-VIFPVBQESA-N
MW209.08 g/mol
LogP-0.30
Rot. Bonds2

About [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid

[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid (PubChem CID 99738203) has the molecular formula C9H12BNO2S and a molecular weight of 209.08 g/mol. Its IUPAC name is [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid.

Molecular Properties

Compound Name[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid
PubChem CID99738203
Molecular FormulaC9H12BNO2S
Molecular Weight209.08 g/mol
Exact Mass209.07
IUPAC Name[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid
SMILESOB(O)c1ccc([C@H]2NCCS2)cc1
InChIInChI=1S/C9H12BNO2S/c12-10(13)8-3-1-7(2-4-8)9-11-5-6-14-9/h1-4,9,11-13H,5-6H2/t9-/m0/s1
InChIKeyJXWCKTPGUFGAKU-VIFPVBQESA-N
XLogP-0.30
TPSA52.49 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.08
LogP ≤ 5-0.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
The IUPAC name of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid (CID 99738203) is [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid.
What is the SMILES notation for [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
The canonical SMILES for [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid is OB(O)c1ccc([C@H]2NCCS2)cc1.
What is the InChIKey of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
The InChIKey is JXWCKTPGUFGAKU-VIFPVBQESA-N. The full InChI is InChI=1S/C9H12BNO2S/c12-10(13)8-3-1-7(2-4-8)9-11-5-6-14-9/h1-4,9,11-13H,5-6H2/t9-/m0/s1.
What are the key properties of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid has a molecular weight of 209.08 g/mol, XLogP of -0.30, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid is sourced from PubChem (CID 99738203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).