About [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid
[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid (PubChem CID 99738203) has the molecular formula C9H12BNO2S
and a molecular weight of 209.08 g/mol. Its IUPAC name is [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid |
| PubChem CID | 99738203 |
| Molecular Formula | C9H12BNO2S |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc([C@H]2NCCS2)cc1 |
| InChI | InChI=1S/C9H12BNO2S/c12-10(13)8-3-1-7(2-4-8)9-11-5-6-14-9/h1-4,9,11-13H,5-6H2/t9-/m0/s1 |
| InChIKey | JXWCKTPGUFGAKU-VIFPVBQESA-N |
| XLogP | -0.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
The IUPAC name of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid (CID 99738203) is [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid.
What is the SMILES notation for [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
The canonical SMILES for [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid is OB(O)c1ccc([C@H]2NCCS2)cc1.
What is the InChIKey of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
The InChIKey is JXWCKTPGUFGAKU-VIFPVBQESA-N. The full InChI is InChI=1S/C9H12BNO2S/c12-10(13)8-3-1-7(2-4-8)9-11-5-6-14-9/h1-4,9,11-13H,5-6H2/t9-/m0/s1.
What are the key properties of [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid?
[4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid has a molecular weight of 209.08 g/mol, XLogP of -0.30, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2S)-1,3-thiazolidin-2-yl]phenyl]boronic acid is sourced from PubChem (CID 99738203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).