C19H20N4OS — CID 99741238
5-methyl-N-[(3S)-1-(5-phenyl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 99741238) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 5-methyl-N-[(3S)-1-(5-phenyl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[(3S)-1-(5-phenyl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 99741238 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 5-methyl-N-[(3S)-1-(5-phenyl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CCN(c3cc(-c4ccccc4)[nH]n3)C2)s1 |
| InChI | InChI=1S/C19H20N4OS/c1-13-7-8-17(25-13)19(24)20-15-9-10-23(12-15)18-11-16(21-22-18)14-5-3-2-4-6-14/h2-8,11,15H,9-10,12H2,1H3,(H,20,24)(H,21,22)/t15-/m0/s1 |
| InChIKey | FZLKICGULYBIEV-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |