C25H27N3O5 — CID 99743879
2-[(4R)-4-(2-ethoxyphenyl)-2,5-dioxo-4,7-dihydro-3H-furo[3,4-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 99743879) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[(4R)-4-(2-ethoxyphenyl)-2,5-dioxo-4,7-dihydro-3H-furo[3,4-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(4R)-4-(2-ethoxyphenyl)-2,5-dioxo-4,7-dihydro-3H-furo[3,4-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 99743879 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[(4R)-4-(2-ethoxyphenyl)-2,5-dioxo-4,7-dihydro-3H-furo[3,4-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | CCOc1ccccc1[C@H]1NC(=O)N(CC(=O)NCCCc2ccccc2)C2=C1C(=O)OC2 |
| InChI | InChI=1S/C25H27N3O5/c1-2-32-20-13-7-6-12-18(20)23-22-19(16-33-24(22)30)28(25(31)27-23)15-21(29)26-14-8-11-17-9-4-3-5-10-17/h3-7,9-10,12-13,23H,2,8,11,14-16H2,1H3,(H,26,29)(H,27,31)/t23-/m1/s1 |
| InChIKey | CNTSTXLFNRIRHB-HSZRJFAPSA-N |
| XLogP | 2.71 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|