C19H17N5O2S — CID 99744240
(6R)-6-(2,4-dimethylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (PubChem CID 99744240) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is (6R)-6-(2,4-dimethylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
| Compound Name | (6R)-6-(2,4-dimethylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 99744240 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (6R)-6-(2,4-dimethylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
| SMILES | Cc1ccc([C@@H]2Cn3nnc(-c4nc(-c5ccsc5)no4)c3CO2)c(C)c1 |
| InChI | InChI=1S/C19H17N5O2S/c1-11-3-4-14(12(2)7-11)16-8-24-15(9-25-16)17(21-23-24)19-20-18(22-26-19)13-5-6-27-10-13/h3-7,10,16H,8-9H2,1-2H3/t16-/m0/s1 |
| InChIKey | VTYCZZUZCRTYSL-INIZCTEOSA-N |
| XLogP | 3.94 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |