C22H25N3O2 — CID 99748895
(3aS)-N-[(3,4-dimethylphenyl)methyl]-4-methyl-9-oxo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline-6-carboxamide (PubChem CID 99748895) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (3aS)-N-[(3,4-dimethylphenyl)methyl]-4-methyl-9-oxo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline-6-carboxamide.
| Compound Name | (3aS)-N-[(3,4-dimethylphenyl)methyl]-4-methyl-9-oxo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline-6-carboxamide |
|---|---|
| PubChem CID | 99748895 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (3aS)-N-[(3,4-dimethylphenyl)methyl]-4-methyl-9-oxo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline-6-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc3c(c2)N(C)[C@@H]2CCCN2C3=O)cc1C |
| InChI | InChI=1S/C22H25N3O2/c1-14-6-7-16(11-15(14)2)13-23-21(26)17-8-9-18-19(12-17)24(3)20-5-4-10-25(20)22(18)27/h6-9,11-12,20H,4-5,10,13H2,1-3H3,(H,23,26)/t20-/m0/s1 |
| InChIKey | KJHRTVZPMYPTGM-FQEVSTJZSA-N |
| XLogP | 3.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |