C22H22N6O2 — CID 99756548
(2R)-N-[[7-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-phenylbutanamide (PubChem CID 99756548) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is (2R)-N-[[7-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[[7-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 99756548 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2R)-N-[[7-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)NCc1nnc2cc(-c3nc(C4CC4)no3)ccn12)c1ccccc1 |
| InChI | InChI=1S/C22H22N6O2/c1-2-17(14-6-4-3-5-7-14)21(29)23-13-19-26-25-18-12-16(10-11-28(18)19)22-24-20(27-30-22)15-8-9-15/h3-7,10-12,15,17H,2,8-9,13H2,1H3,(H,23,29)/t17-/m1/s1 |
| InChIKey | BPBZEWRZHXUUSM-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |