C25H30N4O2 — CID 99756654
N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-4-phenylbutanamide (PubChem CID 99756654) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-4-phenylbutanamide.
| Compound Name | N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 99756654 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-4-phenylbutanamide |
| SMILES | COc1ccc(-c2cc(N3CCC[C@@H](NC(=O)CCCc4ccccc4)C3)n[nH]2)cc1 |
| InChI | InChI=1S/C25H30N4O2/c1-31-22-14-12-20(13-15-22)23-17-24(28-27-23)29-16-6-10-21(18-29)26-25(30)11-5-9-19-7-3-2-4-8-19/h2-4,7-8,12-15,17,21H,5-6,9-11,16,18H2,1H3,(H,26,30)(H,27,28)/t21-/m1/s1 |
| InChIKey | QZVZTBRCMOJMAT-OAQYLSRUSA-N |
| XLogP | 4.19 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |