C25H30N4O3 — CID 99759064
(5aS)-5-ethyl-N-(4-morpholin-4-ylphenyl)-11-oxo-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide (PubChem CID 99759064) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (5aS)-5-ethyl-N-(4-morpholin-4-ylphenyl)-11-oxo-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide.
| Compound Name | (5aS)-5-ethyl-N-(4-morpholin-4-ylphenyl)-11-oxo-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 99759064 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (5aS)-5-ethyl-N-(4-morpholin-4-ylphenyl)-11-oxo-6,7,8,9-tetrahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide |
| SMILES | CCN1c2cc(C(=O)Nc3ccc(N4CCOCC4)cc3)ccc2C(=O)N2CCCC[C@H]21 |
| InChI | InChI=1S/C25H30N4O3/c1-2-28-22-17-18(6-11-21(22)25(31)29-12-4-3-5-23(28)29)24(30)26-19-7-9-20(10-8-19)27-13-15-32-16-14-27/h6-11,17,23H,2-5,12-16H2,1H3,(H,26,30)/t23-/m0/s1 |
| InChIKey | BRQVYQWJNKRYLB-QHCPKHFHSA-N |
| XLogP | 3.57 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|