About [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine
[(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine (PubChem CID 9976640) has the molecular formula C26H31NO
and a molecular weight of 373.50 g/mol. Its IUPAC name is (2S)-3-[(3,5-dimethylphenyl)methoxy]-N,N-dimethyl-1,1-diphenylpropan-2-amine.
Molecular Properties
| Compound Name | [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine |
| PubChem CID | 9976640 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (2S)-3-[(3,5-dimethylphenyl)methoxy]-N,N-dimethyl-1,1-diphenylpropan-2-amine |
| SMILES | CC1=CC(=CC(=C1)COC[C@H](C(C2=CC=CC=C2)C3=CC=CC=C3)N(C)C)C |
| InChI | InChI=1S/C26H31NO/c1-20-15-21(2)17-22(16-20)18-28-19-25(27(3)4)26(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-17,25-26H,18-19H2,1-4H3/t25-/m1/s1 |
| InChIKey | KYAGVGRXHALGSE-RUZDIDTESA-N |
| XLogP | 5.80 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | 396 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine?
The IUPAC name of [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine (CID 9976640) is (2S)-3-[(3,5-dimethylphenyl)methoxy]-N,N-dimethyl-1,1-diphenylpropan-2-amine.
What is the SMILES notation for [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine?
The canonical SMILES for [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine is CC1=CC(=CC(=C1)COC[C@H](C(C2=CC=CC=C2)C3=CC=CC=C3)N(C)C)C.
What is the InChIKey of [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine?
The InChIKey is KYAGVGRXHALGSE-RUZDIDTESA-N. The full InChI is InChI=1S/C26H31NO/c1-20-15-21(2)17-22(16-20)18-28-19-25(27(3)4)26(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-17,25-26H,18-19H2,1-4H3/t25-/m1/s1.
What are the key properties of [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine?
[(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine has a molecular weight of 373.50 g/mol, XLogP of 5.80, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-1-(3,5-Dimethyl-benzyloxymethyl)-2,2-diphenyl-ethyl]-dimethyl-amine is sourced from PubChem (CID 9976640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).