About N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide
N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide (PubChem CID 99770159) has the molecular formula C8H11F6NO2
and a molecular weight of 267.17 g/mol. Its IUPAC name is N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide.
Molecular Properties
| Compound Name | N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide |
| PubChem CID | 99770159 |
| Molecular Formula | C8H11F6NO2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide |
| SMILES | CCCCNC(=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H11F6NO2/c1-2-3-4-15-5(16)6(17,7(9,10)11)8(12,13)14/h17H,2-4H2,1H3,(H,15,16) |
| InChIKey | BXWYOXXZMKITKA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
The IUPAC name of N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide (CID 99770159) is N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide.
What is the SMILES notation for N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
The canonical SMILES for N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide is CCCCNC(=O)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
The InChIKey is BXWYOXXZMKITKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F6NO2/c1-2-3-4-15-5(16)6(17,7(9,10)11)8(12,13)14/h17H,2-4H2,1H3,(H,15,16).
What are the key properties of N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide has a molecular weight of 267.17 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide is sourced from PubChem (CID 99770159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).