C8H8BrF2NO — CID 99770347
3-bromo-5-(2,2-difluoroethoxy)aniline (PubChem CID 99770347) has the molecular formula C8H8BrF2NO and a molecular weight of 252.06 g/mol. Its IUPAC name is 3-bromo-5-(2,2-difluoroethoxy)aniline.
| Compound Name | 3-bromo-5-(2,2-difluoroethoxy)aniline |
|---|---|
| PubChem CID | 99770347 |
| Molecular Formula | C8H8BrF2NO |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 3-bromo-5-(2,2-difluoroethoxy)aniline |
| SMILES | Nc1cc(Br)cc(OCC(F)F)c1 |
| InChI | InChI=1S/C8H8BrF2NO/c9-5-1-6(12)3-7(2-5)13-4-8(10)11/h1-3,8H,4,12H2 |
| InChIKey | HUYCNFAHIXQTIG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|